Alisol B acetate

DESCRIPTION

Alisol B acetate can induce Bax nuclear translocation and apoptosis in human hormone-resistant prostate cancer PC-3 cells, the Bax activation and translocation from the cytosol to nucleus might be a crucial response to the apoptotic effect. Alisol B acetate exhibits an antiproliferative effect in SGC7901 cells by inducing apoptosis, apoptosis of SGC7901 cells involves mitochondria-caspase and PI3K/Akt dependent pathways.

DETAILS

Cas: 19865-76-0
Purity: 98%
Smiles: C[C@@]12[C@]([C@]3(C)[C@@](CC1)(C(C)(C)C(=O)CC3)[H])([C@@H](O)CC=4[C@]2(C)CCC4[C@@H](C[C@@H](C(C(C)C)=O)OC(C)=O)C)[H]
Category: Compound
Molecular Weight: 514.74
Molecular Formula: C32H50O5

Lead Time: 4 - 5 weeks