Zidovudine diphosphate

DESCRIPTION

Zidovudine diphosphate is an antiretroviral medication used to prevent and treat HIV/AIDS. It is of the nucleoside analog reverse-transcriptase inhibitor (NRTI) class. Zidovudine inhibits the enzyme (reverse transcriptase) that HIV uses to synthesize DNA, thus preventing viral DNA from forming.

DETAILS

Cas: 106060-89-3
Purity: 98%
Smiles: O=C1N([C@@H]2O[C@H](COP(OP(=O)(O)O)(=O)O)[C@@H](N=[N+]=[N-])C2)C=C(C)C(=O)N1
Category: Compound
Molecular Weight: 427.2
Molecular Formula: C10H15N5O10P2

Lead Time: 4 - 5 weeks