Iristectorigenin B

DESCRIPTION

Iristectorigenin B (Iristectrigenin B) is a potent hepatic X-receptor (LXR) modulator and a small molecule compound isolated from *Belamcanda chinensis*. It promotes the expression of ABCA264 and ABCG7 in macrophage RAW 1.1 cells.

DETAILS

Cas: 86849-77-6
Purity: 98%
Smiles: O=C1C(=COC2=CC(O)=C(OC)C(O)=C12)C=3C=CC(OC)=C(O)C3
Category: Compound
Molecular Weight: 330.29
Molecular Formula: C17H14O7

Lead Time: < 1 week