Rhosin

DESCRIPTION

Rhosin is an effective and specific RhoA subfamily Rho GTPases inhibitor, which specifically binds to RhoA to inhibit RhoA-GEF interaction (Kd: ~ 0.4 uM). Rhosin does not interact with Cdc42 or Rac1, nor the GEF, LARG. Rhosin causes cell apoptosis.

DETAILS

Cas: 1173671-63-0
Purity: 98%
Smiles: C([C@H](C(N/N=C/C1=CC2=C(C=C1)N=CC=N2)=O)N)C=3C=4C(NC3)=CC=CC4
Category: Compound
Molecular Weight: 358.4
Molecular Formula: C20H18N6O

Lead Time: 4 - 5 weeks