(R)-2-((tert-Butoxycarbonyl)amino)pent-4-ynoic acid

DETAILS

Purity: >98%
Smiles: C#CC[C@@H](NC(OC(C)(C)C)=O)C(O)=O
Category: Polypeptide
Lead Time: 1-2 days
Cas Number: 63039-46-3
Molecular Weight: 213.23
Molecular Formula: C10H15NO4

DESCRIPTION

(R)-2-((tert-Butoxycarbonyl)amino)pent-4-ynoic acid is a Glycine (HY-Y0966) derivative[1]. (R)-2-((tert-Butoxycarbonyl)amino)pent-4-ynoic acid is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.

Lead Time: 1-2 days